C17H13ClF3NO4S — CID 42966409
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate (PubChem CID 42966409) has the molecular formula C17H13ClF3NO4S and a molecular weight of 419.81 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 42966409 |
| Molecular Formula | C17H13ClF3NO4S |
| Molecular Weight | 419.81 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1ccc(Cl)s1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13ClF3NO4S/c18-14-6-5-13(27-14)12(23)4-7-16(25)26-9-15(24)22-11-3-1-2-10(8-11)17(19,20)21/h1-3,5-6,8H,4,7,9H2,(H,22,24) |
| InChIKey | VUMVWTCRAKEJRP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.81 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |