C17H14ClF3N2O4S — CID 55350664
4-(5-chlorothiophen-2-yl)-4-oxo-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]butanehydrazide (PubChem CID 55350664) has the molecular formula C17H14ClF3N2O4S and a molecular weight of 434.82 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-4-oxo-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]butanehydrazide.
| Compound Name | 4-(5-chlorothiophen-2-yl)-4-oxo-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]butanehydrazide |
|---|---|
| PubChem CID | 55350664 |
| Molecular Formula | C17H14ClF3N2O4S |
| Molecular Weight | 434.82 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-4-oxo-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]butanehydrazide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)s1)NNC(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14ClF3N2O4S/c18-14-6-5-13(28-14)12(24)4-7-15(25)22-23-16(26)9-27-11-3-1-2-10(8-11)17(19,20)21/h1-3,5-6,8H,4,7,9H2,(H,22,25)(H,23,26) |
| InChIKey | AQXMVJRRNGZPDI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|