C14H12ClF3N2OS — CID 56518742
3-(5-chlorothiophen-2-yl)-N'-[3-(trifluoromethyl)phenyl]propanehydrazide (PubChem CID 56518742) has the molecular formula C14H12ClF3N2OS and a molecular weight of 348.78 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N'-[3-(trifluoromethyl)phenyl]propanehydrazide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N'-[3-(trifluoromethyl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 56518742 |
| Molecular Formula | C14H12ClF3N2OS |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N'-[3-(trifluoromethyl)phenyl]propanehydrazide |
| SMILES | O=C(CCc1ccc(Cl)s1)NNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12ClF3N2OS/c15-12-6-4-11(22-12)5-7-13(21)20-19-10-3-1-2-9(8-10)14(16,17)18/h1-4,6,8,19H,5,7H2,(H,20,21) |
| InChIKey | OCXIXMUQMVXBEE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|