C18H20F3N3O3 — CID 51537955
3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N'-[3-(trifluoromethyl)phenyl]propanehydrazide (PubChem CID 51537955) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N'-[3-(trifluoromethyl)phenyl]propanehydrazide.
| Compound Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N'-[3-(trifluoromethyl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 51537955 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N'-[3-(trifluoromethyl)phenyl]propanehydrazide |
| SMILES | O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)NNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20F3N3O3/c19-18(20,21)11-4-3-5-12(10-11)22-23-15(25)8-9-24-16(26)13-6-1-2-7-14(13)17(24)27/h3-5,10,13-14,22H,1-2,6-9H2,(H,23,25)/t13-,14-/m1/s1 |
| InChIKey | BUOXYPPZCCOKAJ-ZIAGYGMSSA-N |
| XLogP | 2.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|