C21H26F3N3O2 — CID 55560590
2-(1-adamantyl)-N-[2-oxo-2-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]ethyl]acetamide (PubChem CID 55560590) has the molecular formula C21H26F3N3O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-oxo-2-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]ethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-oxo-2-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]ethyl]acetamide |
|---|---|
| PubChem CID | 55560590 |
| Molecular Formula | C21H26F3N3O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-oxo-2-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]ethyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCC(=O)NNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H26F3N3O2/c22-21(23,24)16-2-1-3-17(7-16)26-27-19(29)12-25-18(28)11-20-8-13-4-14(9-20)6-15(5-13)10-20/h1-3,7,13-15,26H,4-6,8-12H2,(H,25,28)(H,27,29) |
| InChIKey | SJOJDCDWSVATIT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|