C24H27F3N2O2 — CID 31872240
2-(1-adamantyl)-N-[2-oxo-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]ethyl]acetamide (PubChem CID 31872240) has the molecular formula C24H27F3N2O2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-oxo-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]ethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-oxo-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 31872240 |
| Molecular Formula | C24H27F3N2O2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-oxo-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]ethyl]acetamide |
| SMILES | O=C(CNC(=O)CC12CC3CC(CC(C3)C1)C2)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H27F3N2O2/c25-24(26,27)20-5-1-3-16(10-20)4-2-6-28-22(31)15-29-21(30)14-23-11-17-7-18(12-23)9-19(8-17)13-23/h1,3,5,10,17-19H,6-9,11-15H2,(H,28,31)(H,29,30) |
| InChIKey | MHXWQEWOYKNMNU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|