C22H20F3NO2S2 — CID 31871918
2-[4-(1,3-dithian-2-yl)phenoxy]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide (PubChem CID 31871918) has the molecular formula C22H20F3NO2S2 and a molecular weight of 451.54 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)phenoxy]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide.
| Compound Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 31871918 |
| Molecular Formula | C22H20F3NO2S2 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
| SMILES | O=C(COc1ccc(C2SCCCS2)cc1)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3NO2S2/c23-22(24,25)18-6-1-4-16(14-18)5-2-11-26-20(27)15-28-19-9-7-17(8-10-19)21-29-12-3-13-30-21/h1,4,6-10,14,21H,3,11-13,15H2,(H,26,27) |
| InChIKey | FZMNJDRCDYUCLW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|