C17H20F3N3S — CID 111997783
2-methyl-1-(thian-3-yl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 111997783) has the molecular formula C17H20F3N3S and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-methyl-1-(thian-3-yl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 2-methyl-1-(thian-3-yl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 111997783 |
| Molecular Formula | C17H20F3N3S |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-methyl-1-(thian-3-yl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | C/N=C(\NCC#Cc1cccc(C(F)(F)F)c1)NC1CCCSC1 |
| InChI | InChI=1S/C17H20F3N3S/c1-21-16(23-15-8-4-10-24-12-15)22-9-3-6-13-5-2-7-14(11-13)17(18,19)20/h2,5,7,11,15H,4,8-10,12H2,1H3,(H2,21,22,23) |
| InChIKey | OJLKVVQHMDIAIF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|