C17H15Cl2NO4S — CID 7238039
[2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate (PubChem CID 7238039) has the molecular formula C17H15Cl2NO4S and a molecular weight of 400.28 g/mol. Its IUPAC name is [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate.
| Compound Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7238039 |
| Molecular Formula | C17H15Cl2NO4S |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1ccc(Cl)s1)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2NO4S/c18-12-3-1-2-11(8-12)9-20-16(22)10-24-17(23)7-4-13(21)14-5-6-15(19)25-14/h1-3,5-6,8H,4,7,9-10H2,(H,20,22) |
| InChIKey | CUKWJTIQUDOKCJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |