C16H12Cl2FNO4S — CID 7238018
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate (PubChem CID 7238018) has the molecular formula C16H12Cl2FNO4S and a molecular weight of 404.25 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7238018 |
| Molecular Formula | C16H12Cl2FNO4S |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1ccc(Cl)s1)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C16H12Cl2FNO4S/c17-9-1-2-10(19)11(7-9)20-15(22)8-24-16(23)6-3-12(21)13-4-5-14(18)25-13/h1-2,4-5,7H,3,6,8H2,(H,20,22) |
| InChIKey | QTPFPKVUZXOVPV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |