C17H14ClNO5S — CID 7583505
(2-benzamido-2-oxoethyl) 4-(5-chlorothiophen-2-yl)-4-oxobutanoate (PubChem CID 7583505) has the molecular formula C17H14ClNO5S and a molecular weight of 379.82 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 4-(5-chlorothiophen-2-yl)-4-oxobutanoate.
| Compound Name | (2-benzamido-2-oxoethyl) 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7583505 |
| Molecular Formula | C17H14ClNO5S |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1ccc(Cl)s1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H14ClNO5S/c18-14-8-7-13(25-14)12(20)6-9-16(22)24-10-15(21)19-17(23)11-4-2-1-3-5-11/h1-5,7-8H,6,9-10H2,(H,19,21,23) |
| InChIKey | DJVVVVHUTPXDCB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |