C18H16F3NO4S — CID 29484980
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate (PubChem CID 29484980) has the molecular formula C18H16F3NO4S and a molecular weight of 399.39 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 29484980 |
| Molecular Formula | C18H16F3NO4S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
| SMILES | Cc1ccc(C(=O)CCC(=O)OCC(=O)Nc2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C18H16F3NO4S/c1-11-5-7-15(27-11)14(23)6-8-17(25)26-10-16(24)22-13-4-2-3-12(9-13)18(19,20)21/h2-5,7,9H,6,8,10H2,1H3,(H,22,24) |
| InChIKey | OECRIDZOSFWNIL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |