C16H20ClNO3 — CID 8662028
(4-chlorophenyl)methyl 2-(cyclohexanecarbonylamino)acetate (PubChem CID 8662028) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 2-(cyclohexanecarbonylamino)acetate.
| Compound Name | (4-chlorophenyl)methyl 2-(cyclohexanecarbonylamino)acetate |
|---|---|
| PubChem CID | 8662028 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (4-chlorophenyl)methyl 2-(cyclohexanecarbonylamino)acetate |
| SMILES | O=C(CNC(=O)C1CCCCC1)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO3/c17-14-8-6-12(7-9-14)11-21-15(19)10-18-16(20)13-4-2-1-3-5-13/h6-9,13H,1-5,10-11H2,(H,18,20) |
| InChIKey | WIYBUTVIOCPOCQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |