C10H7Cl2F3N2O2 — CID 98107995
[(Z)-1,2-dichloroethylideneamino] N-[2-(trifluoromethyl)phenyl]carbamate (PubChem CID 98107995) has the molecular formula C10H7Cl2F3N2O2 and a molecular weight of 315.08 g/mol. Its IUPAC name is [(Z)-1,2-dichloroethylideneamino] N-[2-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [(Z)-1,2-dichloroethylideneamino] N-[2-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 98107995 |
| Molecular Formula | C10H7Cl2F3N2O2 |
| Molecular Weight | 315.08 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | [(Z)-1,2-dichloroethylideneamino] N-[2-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)O/N=C(\Cl)CCl |
| InChI | InChI=1S/C10H7Cl2F3N2O2/c11-5-8(12)17-19-9(18)16-7-4-2-1-3-6(7)10(13,14)15/h1-4H,5H2,(H,16,18)/b17-8- |
| InChIKey | MSCCQAZNRMGDGY-IUXPMGMMSA-N |
| XLogP | 4.05 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.08 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|