C26H25Cl2N3O3S — CID 4935251
2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]-N-(1-phenylethyl)benzamide (PubChem CID 4935251) has the molecular formula C26H25Cl2N3O3S and a molecular weight of 530.48 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]-N-(1-phenylethyl)benzamide.
| Compound Name | 2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4935251 |
| Molecular Formula | C26H25Cl2N3O3S |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccccc1NC(=S)NC(=O)CCCOc1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C26H25Cl2N3O3S/c1-17(18-8-3-2-4-9-18)29-25(33)20-10-5-6-11-22(20)30-26(35)31-24(32)12-7-15-34-23-14-13-19(27)16-21(23)28/h2-6,8-11,13-14,16-17H,7,12,15H2,1H3,(H,29,33)(H2,30,31,32,35) |
| InChIKey | QYBUERWLHDQMEF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|