C19H28N2O3S — CID 54786678
2-cyclopentyl-N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]acetamide (PubChem CID 54786678) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]acetamide |
|---|---|
| PubChem CID | 54786678 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-cyclopentyl-N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]acetamide |
| SMILES | CCCOc1ccc(CNC(=S)NC(=O)CC2CCCC2)cc1OC |
| InChI | InChI=1S/C19H28N2O3S/c1-3-10-24-16-9-8-15(11-17(16)23-2)13-20-19(25)21-18(22)12-14-6-4-5-7-14/h8-9,11,14H,3-7,10,12-13H2,1-2H3,(H2,20,21,22,25) |
| InChIKey | SXSQKZBUIOFOIS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|