C24H32N2O4S — CID 54777242
N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]-3-(3-methylbutoxy)benzamide (PubChem CID 54777242) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]-3-(3-methylbutoxy)benzamide.
| Compound Name | N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]-3-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 54777242 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]-3-(3-methylbutoxy)benzamide |
| SMILES | CCCOc1ccc(CNC(=S)NC(=O)c2cccc(OCCC(C)C)c2)cc1OC |
| InChI | InChI=1S/C24H32N2O4S/c1-5-12-30-21-10-9-18(14-22(21)28-4)16-25-24(31)26-23(27)19-7-6-8-20(15-19)29-13-11-17(2)3/h6-10,14-15,17H,5,11-13,16H2,1-4H3,(H2,25,26,27,31) |
| InChIKey | GJBRINKBYBLLIN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|