C24H32N2O6S — CID 54776880
3,4,5-trimethoxy-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylcarbamothioyl]benzamide (PubChem CID 54776880) has the molecular formula C24H32N2O6S and a molecular weight of 476.60 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylcarbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylcarbamothioyl]benzamide |
|---|---|
| PubChem CID | 54776880 |
| Molecular Formula | C24H32N2O6S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylcarbamothioyl]benzamide |
| SMILES | COc1cc(CNC(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)ccc1OCCC(C)C |
| InChI | InChI=1S/C24H32N2O6S/c1-15(2)9-10-32-18-8-7-16(11-19(18)28-3)14-25-24(33)26-23(27)17-12-20(29-4)22(31-6)21(13-17)30-5/h7-8,11-13,15H,9-10,14H2,1-6H3,(H2,25,26,27,33) |
| InChIKey | CVOPKMKFDCCJHF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|