C21H26N2O3S2 — CID 54776893
(E)-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylcarbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 54776893) has the molecular formula C21H26N2O3S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is (E)-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylcarbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylcarbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 54776893 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (E)-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylcarbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | COc1cc(CNC(=S)NC(=O)/C=C/c2cccs2)ccc1OCCC(C)C |
| InChI | InChI=1S/C21H26N2O3S2/c1-15(2)10-11-26-18-8-6-16(13-19(18)25-3)14-22-21(27)23-20(24)9-7-17-5-4-12-28-17/h4-9,12-13,15H,10-11,14H2,1-3H3,(H2,22,23,24,27)/b9-7+ |
| InChIKey | DIJAVKRPBVADSM-VQHVLOKHSA-N |
| XLogP | 4.39 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|