C20H18N2OS2 — CID 1302090
N-[(3-methylsulfanylphenyl)carbamothioyl]-2-naphthalen-1-ylacetamide (PubChem CID 1302090) has the molecular formula C20H18N2OS2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[(3-methylsulfanylphenyl)carbamothioyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(3-methylsulfanylphenyl)carbamothioyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 1302090 |
| Molecular Formula | C20H18N2OS2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[(3-methylsulfanylphenyl)carbamothioyl]-2-naphthalen-1-ylacetamide |
| SMILES | CSc1cccc(NC(=S)NC(=O)Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C20H18N2OS2/c1-25-17-10-5-9-16(13-17)21-20(24)22-19(23)12-15-8-4-7-14-6-2-3-11-18(14)15/h2-11,13H,12H2,1H3,(H2,21,22,23,24) |
| InChIKey | QHIQGXRZKHPJPZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|