C36H34N4O3S2 — CID 4946590
N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-naphthalen-1-ylacetamide (PubChem CID 4946590) has the molecular formula C36H34N4O3S2 and a molecular weight of 634.83 g/mol. Its IUPAC name is N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 4946590 |
| Molecular Formula | C36H34N4O3S2 |
| Molecular Weight | 634.83 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)NC(=S)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C36H34N4O3S2/c41-34(26-30-16-9-15-27-10-7-8-17-33(27)30)38-36(44)37-31-18-20-32(21-19-31)45(42,43)40-24-22-39(23-25-40)35(28-11-3-1-4-12-28)29-13-5-2-6-14-29/h1-21,35H,22-26H2,(H2,37,38,41,44) |
| InChIKey | ARHUVNLELDSRJS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.83 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|