C35H40N4O3S2 — CID 54784856
N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]adamantane-1-carboxamide (PubChem CID 54784856) has the molecular formula C35H40N4O3S2 and a molecular weight of 628.86 g/mol. Its IUPAC name is N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]adamantane-1-carboxamide.
| Compound Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 54784856 |
| Molecular Formula | C35H40N4O3S2 |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]adamantane-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C35H40N4O3S2/c40-33(35-22-25-19-26(23-35)21-27(20-25)24-35)37-34(43)36-30-11-13-31(14-12-30)44(41,42)39-17-15-38(16-18-39)32(28-7-3-1-4-8-28)29-9-5-2-6-10-29/h1-14,25-27,32H,15-24H2,(H2,36,37,40,43) |
| InChIKey | OXWFARPGFVUYTD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|