C33H40N4O3S2 — CID 4934530
N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-3-cyclohexylpropanamide (PubChem CID 4934530) has the molecular formula C33H40N4O3S2 and a molecular weight of 604.84 g/mol. Its IUPAC name is N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-3-cyclohexylpropanamide.
| Compound Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 4934530 |
| Molecular Formula | C33H40N4O3S2 |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-3-cyclohexylpropanamide |
| SMILES | O=C(CCC1CCCCC1)NC(=S)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C33H40N4O3S2/c38-31(21-16-26-10-4-1-5-11-26)35-33(41)34-29-17-19-30(20-18-29)42(39,40)37-24-22-36(23-25-37)32(27-12-6-2-7-13-27)28-14-8-3-9-15-28/h2-3,6-9,12-15,17-20,26,32H,1,4-5,10-11,16,21-25H2,(H2,34,35,38,41) |
| InChIKey | WPIBEJAMGXTKJE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|