C23H31N3O3S2 — CID 54787521
N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]adamantane-1-carboxamide (PubChem CID 54787521) has the molecular formula C23H31N3O3S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]adamantane-1-carboxamide.
| Compound Name | N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 54787521 |
| Molecular Formula | C23H31N3O3S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]adamantane-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31N3O3S2/c27-21(23-13-16-10-17(14-23)12-18(11-16)15-23)25-22(30)24-19-4-6-20(7-5-19)31(28,29)26-8-2-1-3-9-26/h4-7,16-18H,1-3,8-15H2,(H2,24,25,27,30) |
| InChIKey | XVVYEFUCQFKXJV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|