C24H29N5O3S2 — CID 3414631
N-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]adamantane-1-carboxamide (PubChem CID 3414631) has the molecular formula C24H29N5O3S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]adamantane-1-carboxamide.
| Compound Name | N-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 3414631 |
| Molecular Formula | C24H29N5O3S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]adamantane-1-carboxamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C34CC5CC(CC(C5)C3)C4)cc2)nc(C)n1 |
| InChI | InChI=1S/C24H29N5O3S2/c1-14-7-21(26-15(2)25-14)29-34(31,32)20-5-3-19(4-6-20)27-23(33)28-22(30)24-11-16-8-17(12-24)10-18(9-16)13-24/h3-7,16-18H,8-13H2,1-2H3,(H,25,26,29)(H2,27,28,30,33) |
| InChIKey | GCVZSPUQUQCZEI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|