C18H21BrN2OS — CID 54787547
N-[(4-bromophenyl)carbamothioyl]adamantane-1-carboxamide (PubChem CID 54787547) has the molecular formula C18H21BrN2OS and a molecular weight of 393.35 g/mol. Its IUPAC name is N-[(4-bromophenyl)carbamothioyl]adamantane-1-carboxamide.
| Compound Name | N-[(4-bromophenyl)carbamothioyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 54787547 |
| Molecular Formula | C18H21BrN2OS |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-[(4-bromophenyl)carbamothioyl]adamantane-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(Br)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H21BrN2OS/c19-14-1-3-15(4-2-14)20-17(23)21-16(22)18-8-11-5-12(9-18)7-13(6-11)10-18/h1-4,11-13H,5-10H2,(H2,20,21,22,23) |
| InChIKey | XACRCBUKWINJRV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|