C23H31N3O2S — CID 54787833
N-[[4-(tert-butylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide (PubChem CID 54787833) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is N-[[4-(tert-butylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide.
| Compound Name | N-[[4-(tert-butylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 54787833 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[[4-(tert-butylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1ccc(NC(=S)NC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H31N3O2S/c1-22(2,3)26-19(27)17-4-6-18(7-5-17)24-21(29)25-20(28)23-11-14-8-15(12-23)10-16(9-14)13-23/h4-7,14-16H,8-13H2,1-3H3,(H,26,27)(H2,24,25,28,29) |
| InChIKey | VMYDYPONEYHRSJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|