C27H32N2O3S — CID 46100935
1-benzhydryl-4-(4-butoxyphenyl)sulfonylpiperazine (PubChem CID 46100935) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is 1-benzhydryl-4-(4-butoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-benzhydryl-4-(4-butoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 46100935 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-benzhydryl-4-(4-butoxyphenyl)sulfonylpiperazine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H32N2O3S/c1-2-3-22-32-25-14-16-26(17-15-25)33(30,31)29-20-18-28(19-21-29)27(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-17,27H,2-3,18-22H2,1H3 |
| InChIKey | CJDZMXYDKUBRON-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|