C28H33NO4S — CID 3805662
[1-(4-butoxyphenyl)sulfonylpiperidin-4-yl]-diphenylmethanol (PubChem CID 3805662) has the molecular formula C28H33NO4S and a molecular weight of 479.64 g/mol. Its IUPAC name is [1-(4-butoxyphenyl)sulfonylpiperidin-4-yl]-diphenylmethanol.
| Compound Name | [1-(4-butoxyphenyl)sulfonylpiperidin-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 3805662 |
| Molecular Formula | C28H33NO4S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | [1-(4-butoxyphenyl)sulfonylpiperidin-4-yl]-diphenylmethanol |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H33NO4S/c1-2-3-22-33-26-14-16-27(17-15-26)34(31,32)29-20-18-25(19-21-29)28(30,23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-17,25,30H,2-3,18-22H2,1H3 |
| InChIKey | JJEUVIHPNKXBQQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|