C24H23F2NO3S — CID 14407073
[1-(benzenesulfonyl)piperidin-4-yl]-bis(4-fluorophenyl)methanol (PubChem CID 14407073) has the molecular formula C24H23F2NO3S and a molecular weight of 443.52 g/mol. Its IUPAC name is [1-(benzenesulfonyl)piperidin-4-yl]-bis(4-fluorophenyl)methanol.
| Compound Name | [1-(benzenesulfonyl)piperidin-4-yl]-bis(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 14407073 |
| Molecular Formula | C24H23F2NO3S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [1-(benzenesulfonyl)piperidin-4-yl]-bis(4-fluorophenyl)methanol |
| SMILES | O=S(=O)(c1ccccc1)N1CCC(C(O)(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H23F2NO3S/c25-21-10-6-18(7-11-21)24(28,19-8-12-22(26)13-9-19)20-14-16-27(17-15-20)31(29,30)23-4-2-1-3-5-23/h1-13,20,28H,14-17H2 |
| InChIKey | DSYDHOCJESYUDE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |