C25H28FN3O4S — CID 24655315
1-(2-fluorophenyl)-N-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 24655315) has the molecular formula C25H28FN3O4S and a molecular weight of 485.58 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 24655315 |
| Molecular Formula | C25H28FN3O4S |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(NC(=O)c3cc(C)n(-c4ccccc4F)c3C)CC2)cc1 |
| InChI | InChI=1S/C25H28FN3O4S/c1-17-16-22(18(2)29(17)24-7-5-4-6-23(24)26)25(30)27-19-12-14-28(15-13-19)34(31,32)21-10-8-20(33-3)9-11-21/h4-11,16,19H,12-15H2,1-3H3,(H,27,30) |
| InChIKey | HBEWFALAYAYEDR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|