C18H25FN2 — CID 90191062
2-cyclopentyl-5-(2-fluoro-4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 90191062) has the molecular formula C18H25FN2 and a molecular weight of 288.41 g/mol. Its IUPAC name is 2-cyclopentyl-5-(2-fluoro-4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 2-cyclopentyl-5-(2-fluoro-4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 90191062 |
| Molecular Formula | C18H25FN2 |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-cyclopentyl-5-(2-fluoro-4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Cc1ccc(N2CC3CN(C4CCCC4)CC3C2)c(F)c1 |
| InChI | InChI=1S/C18H25FN2/c1-13-6-7-18(17(19)8-13)21-11-14-9-20(10-15(14)12-21)16-4-2-3-5-16/h6-8,14-16H,2-5,9-12H2,1H3 |
| InChIKey | MTMUDRTYVRWXCZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |