C16H25FN2 — CID 64943133
1-(2-fluoro-4-methylphenyl)-3-(2-methylpropyl)-1,4-diazepane (PubChem CID 64943133) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is 1-(2-fluoro-4-methylphenyl)-3-(2-methylpropyl)-1,4-diazepane.
| Compound Name | 1-(2-fluoro-4-methylphenyl)-3-(2-methylpropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64943133 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 1-(2-fluoro-4-methylphenyl)-3-(2-methylpropyl)-1,4-diazepane |
| SMILES | Cc1ccc(N2CCCNC(CC(C)C)C2)c(F)c1 |
| InChI | InChI=1S/C16H25FN2/c1-12(2)9-14-11-19(8-4-7-18-14)16-6-5-13(3)10-15(16)17/h5-6,10,12,14,18H,4,7-9,11H2,1-3H3 |
| InChIKey | YTNJOMFWCURMHJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |