C15H21F3N2 — CID 64948986
3-(2-methylpropyl)-1-(2,3,5-trifluorophenyl)-1,4-diazepane (PubChem CID 64948986) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 3-(2-methylpropyl)-1-(2,3,5-trifluorophenyl)-1,4-diazepane.
| Compound Name | 3-(2-methylpropyl)-1-(2,3,5-trifluorophenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64948986 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 3-(2-methylpropyl)-1-(2,3,5-trifluorophenyl)-1,4-diazepane |
| SMILES | CC(C)CC1CN(c2cc(F)cc(F)c2F)CCCN1 |
| InChI | InChI=1S/C15H21F3N2/c1-10(2)6-12-9-20(5-3-4-19-12)14-8-11(16)7-13(17)15(14)18/h7-8,10,12,19H,3-6,9H2,1-2H3 |
| InChIKey | ZSRPOEVXZZMDNM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|