C15H22Cl2N2 — CID 64944342
1-(3,4-dichlorophenyl)-3-(2-methylpropyl)-1,4-diazepane (PubChem CID 64944342) has the molecular formula C15H22Cl2N2 and a molecular weight of 301.26 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(2-methylpropyl)-1,4-diazepane.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(2-methylpropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64944342 |
| Molecular Formula | C15H22Cl2N2 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(2-methylpropyl)-1,4-diazepane |
| SMILES | CC(C)CC1CN(c2ccc(Cl)c(Cl)c2)CCCN1 |
| InChI | InChI=1S/C15H22Cl2N2/c1-11(2)8-12-10-19(7-3-6-18-12)13-4-5-14(16)15(17)9-13/h4-5,9,11-12,18H,3,6-8,10H2,1-2H3 |
| InChIKey | CZSOVFBKLMEJQJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |