About N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline
N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline (PubChem CID 64944334) has the molecular formula C17H29N3
and a molecular weight of 275.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline |
| PubChem CID | 64944334 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline |
| SMILES | CC(C)CC1CN(c2ccc(N(C)C)cc2)CCCN1 |
| InChI | InChI=1S/C17H29N3/c1-14(2)12-15-13-20(11-5-10-18-15)17-8-6-16(7-9-17)19(3)4/h6-9,14-15,18H,5,10-13H2,1-4H3 |
| InChIKey | LAYIBGLPFLOCJO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline?
The IUPAC name of N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline (CID 64944334) is N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline.
What is the SMILES notation for N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline?
The canonical SMILES for N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline is CC(C)CC1CN(c2ccc(N(C)C)cc2)CCCN1.
What is the InChIKey of N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline?
The InChIKey is LAYIBGLPFLOCJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3/c1-14(2)12-15-13-20(11-5-10-18-15)17-8-6-16(7-9-17)19(3)4/h6-9,14-15,18H,5,10-13H2,1-4H3.
What are the key properties of N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline?
N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline has a molecular weight of 275.44 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-[3-(2-methylpropyl)-1,4-diazepan-1-yl]aniline is sourced from PubChem (CID 64944334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).