C19H28N2 — CID 159831284
3-cyclohexyl-8-methyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline (PubChem CID 159831284) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 3-cyclohexyl-8-methyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline.
| Compound Name | 3-cyclohexyl-8-methyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline |
|---|---|
| PubChem CID | 159831284 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 3-cyclohexyl-8-methyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline |
| SMILES | Cc1ccc2c(c1)CCC1CN(C3CCCCC3)CCN21 |
| InChI | InChI=1S/C19H28N2/c1-15-7-10-19-16(13-15)8-9-18-14-20(11-12-21(18)19)17-5-3-2-4-6-17/h7,10,13,17-18H,2-6,8-9,11-12,14H2,1H3 |
| InChIKey | PRIPOXKASZTWTH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |