C19H25ClF3N3O2 — CID 175562245
[4-[3-chloro-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]cyclohexyl] carbamate (PubChem CID 175562245) has the molecular formula C19H25ClF3N3O2 and a molecular weight of 419.88 g/mol. Its IUPAC name is [4-[3-chloro-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]cyclohexyl] carbamate.
| Compound Name | [4-[3-chloro-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]cyclohexyl] carbamate |
|---|---|
| PubChem CID | 175562245 |
| Molecular Formula | C19H25ClF3N3O2 |
| Molecular Weight | 419.88 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [4-[3-chloro-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]cyclohexyl] carbamate |
| SMILES | NC(=O)OC1CCC(Nc2ccc(N3CCC(C(F)(F)F)CC3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H25ClF3N3O2/c20-16-11-14(25-13-1-4-15(5-2-13)28-18(24)27)3-6-17(16)26-9-7-12(8-10-26)19(21,22)23/h3,6,11-13,15,25H,1-2,4-5,7-10H2,(H2,24,27) |
| InChIKey | MCESHNIPJQLXDO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|