C14H18N2O2 — CID 166270436
(1-pyridin-2-ylpiperidin-3-yl) cyclopropanecarboxylate (PubChem CID 166270436) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1-pyridin-2-ylpiperidin-3-yl) cyclopropanecarboxylate.
| Compound Name | (1-pyridin-2-ylpiperidin-3-yl) cyclopropanecarboxylate |
|---|---|
| PubChem CID | 166270436 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (1-pyridin-2-ylpiperidin-3-yl) cyclopropanecarboxylate |
| SMILES | O=C(OC1CCCN(c2ccccn2)C1)C1CC1 |
| InChI | InChI=1S/C14H18N2O2/c17-14(11-6-7-11)18-12-4-3-9-16(10-12)13-5-1-2-8-15-13/h1-2,5,8,11-12H,3-4,6-7,9-10H2 |
| InChIKey | HNHAIDMFVBFQRU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |