C17H22F3N3O3 — CID 155949330
N-(oxolan-3-ylmethoxy)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 155949330) has the molecular formula C17H22F3N3O3 and a molecular weight of 373.38 g/mol. Its IUPAC name is N-(oxolan-3-ylmethoxy)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | N-(oxolan-3-ylmethoxy)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155949330 |
| Molecular Formula | C17H22F3N3O3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-(oxolan-3-ylmethoxy)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | O=C(NOCC1CCOC1)C1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C17H22F3N3O3/c18-17(19,20)14-1-2-15(21-9-14)23-6-3-13(4-7-23)16(24)22-26-11-12-5-8-25-10-12/h1-2,9,12-13H,3-8,10-11H2,(H,22,24) |
| InChIKey | SVWULHMQQNFKFL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|