C16H18F3N3O3 — CID 146099466
methyl (E)-4-oxo-4-[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]but-2-enoate (PubChem CID 146099466) has the molecular formula C16H18F3N3O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is methyl (E)-4-oxo-4-[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]but-2-enoate.
| Compound Name | methyl (E)-4-oxo-4-[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 146099466 |
| Molecular Formula | C16H18F3N3O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | methyl (E)-4-oxo-4-[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)N1CCCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C16H18F3N3O3/c1-25-15(24)6-5-14(23)22-8-2-7-21(9-10-22)13-4-3-12(11-20-13)16(17,18)19/h3-6,11H,2,7-10H2,1H3/b6-5+ |
| InChIKey | JPLZLGIWXWVWRP-AATRIKPKSA-N |
| XLogP | 1.87 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|