C10H9F3N6O2S — CID 71995796
5-nitro-2-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]pyrimidine-2,4-diamine (PubChem CID 71995796) has the molecular formula C10H9F3N6O2S and a molecular weight of 334.28 g/mol. Its IUPAC name is 5-nitro-2-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-2-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71995796 |
| Molecular Formula | C10H9F3N6O2S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 5-nitro-2-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCCc2nc(C(F)(F)F)cs2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9F3N6O2S/c11-10(12,13)6-4-22-7(17-6)1-2-15-9-16-3-5(19(20)21)8(14)18-9/h3-4H,1-2H2,(H3,14,15,16,18) |
| InChIKey | ZSORCKRMUANGAZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|