C17H20ClN3O4S2 — CID 133440607
1-[(4-chlorophenyl)methyl]-N-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidin-4-amine (PubChem CID 133440607) has the molecular formula C17H20ClN3O4S2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidin-4-amine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 133440607 |
| Molecular Formula | C17H20ClN3O4S2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidin-4-amine |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(NC2CCN(Cc3ccc(Cl)cc3)CC2)s1 |
| InChI | InChI=1S/C17H20ClN3O4S2/c1-27(24,25)16-10-15(21(22)23)17(26-16)19-14-6-8-20(9-7-14)11-12-2-4-13(18)5-3-12/h2-5,10,14,19H,6-9,11H2,1H3 |
| InChIKey | SQFOLQAJLRNLHU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|