C13H20N2O5S2 — CID 133439540
2,2,5,5-tetramethyl-N-(5-methylsulfonyl-3-nitrothiophen-2-yl)oxolan-3-amine (PubChem CID 133439540) has the molecular formula C13H20N2O5S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-(5-methylsulfonyl-3-nitrothiophen-2-yl)oxolan-3-amine.
| Compound Name | 2,2,5,5-tetramethyl-N-(5-methylsulfonyl-3-nitrothiophen-2-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 133439540 |
| Molecular Formula | C13H20N2O5S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-(5-methylsulfonyl-3-nitrothiophen-2-yl)oxolan-3-amine |
| SMILES | CC1(C)CC(Nc2sc(S(C)(=O)=O)cc2[N+](=O)[O-])C(C)(C)O1 |
| InChI | InChI=1S/C13H20N2O5S2/c1-12(2)7-9(13(3,4)20-12)14-11-8(15(16)17)6-10(21-11)22(5,18)19/h6,9,14H,7H2,1-5H3 |
| InChIKey | KCBDMCIRNDIOFL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|