C15H23NO3S — CID 79927517
2,2,5,5-tetramethyl-N-(3-methylsulfonylphenyl)oxolan-3-amine (PubChem CID 79927517) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-(3-methylsulfonylphenyl)oxolan-3-amine.
| Compound Name | 2,2,5,5-tetramethyl-N-(3-methylsulfonylphenyl)oxolan-3-amine |
|---|---|
| PubChem CID | 79927517 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-(3-methylsulfonylphenyl)oxolan-3-amine |
| SMILES | CC1(C)CC(Nc2cccc(S(C)(=O)=O)c2)C(C)(C)O1 |
| InChI | InChI=1S/C15H23NO3S/c1-14(2)10-13(15(3,4)19-14)16-11-7-6-8-12(9-11)20(5,17)18/h6-9,13,16H,10H2,1-5H3 |
| InChIKey | SXDDYEDRDCRPMC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |