C14H23N3O3S — CID 79912061
2,2,5,5-tetramethyl-3-[3-(sulfamoylamino)anilino]oxolane (PubChem CID 79912061) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-3-[3-(sulfamoylamino)anilino]oxolane.
| Compound Name | 2,2,5,5-tetramethyl-3-[3-(sulfamoylamino)anilino]oxolane |
|---|---|
| PubChem CID | 79912061 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2,2,5,5-tetramethyl-3-[3-(sulfamoylamino)anilino]oxolane |
| SMILES | CC1(C)CC(Nc2cccc(NS(N)(=O)=O)c2)C(C)(C)O1 |
| InChI | InChI=1S/C14H23N3O3S/c1-13(2)9-12(14(3,4)20-13)16-10-6-5-7-11(8-10)17-21(15,18)19/h5-8,12,16-17H,9H2,1-4H3,(H2,15,18,19) |
| InChIKey | HZXAYXJTGDIROQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |