C15H11BrN4O3 — CID 55975866
N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-nitrobenzamide (PubChem CID 55975866) has the molecular formula C15H11BrN4O3 and a molecular weight of 375.18 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-nitrobenzamide.
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 55975866 |
| Molecular Formula | C15H11BrN4O3 |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-nitrobenzamide |
| SMILES | O=C(NCc1cn2cc(Br)ccc2n1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11BrN4O3/c16-10-5-6-14-18-11(9-19(14)8-10)7-17-15(21)12-3-1-2-4-13(12)20(22)23/h1-6,8-9H,7H2,(H,17,21) |
| InChIKey | VHOCDQPRFMJUGP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|