C18H12BrClN4O — CID 55976894
N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-chloroquinoline-4-carboxamide (PubChem CID 55976894) has the molecular formula C18H12BrClN4O and a molecular weight of 415.68 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-chloroquinoline-4-carboxamide.
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-chloroquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55976894 |
| Molecular Formula | C18H12BrClN4O |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-chloroquinoline-4-carboxamide |
| SMILES | O=C(NCc1cn2cc(Br)ccc2n1)c1cc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C18H12BrClN4O/c19-11-5-6-17-22-12(10-24(17)9-11)8-21-18(25)14-7-16(20)23-15-4-2-1-3-13(14)15/h1-7,9-10H,8H2,(H,21,25) |
| InChIKey | IQKPCPYEXCFJNK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|