C18H28N4O5S — CID 100857695
N-[(2R)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-2-methyl-3-nitro-5-sulfamoylbenzamide (PubChem CID 100857695) has the molecular formula C18H28N4O5S and a molecular weight of 412.51 g/mol. Its IUPAC name is N-[(2R)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-2-methyl-3-nitro-5-sulfamoylbenzamide.
| Compound Name | N-[(2R)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-2-methyl-3-nitro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 100857695 |
| Molecular Formula | C18H28N4O5S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[(2R)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-2-methyl-3-nitro-5-sulfamoylbenzamide |
| SMILES | Cc1c(C(=O)N[C@H](C)CN2C[C@H](C)C[C@@H](C)C2)cc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H28N4O5S/c1-11-5-12(2)9-21(8-11)10-13(3)20-18(23)16-6-15(28(19,26)27)7-17(14(16)4)22(24)25/h6-7,11-13H,5,8-10H2,1-4H3,(H,20,23)(H2,19,26,27)/t11-,12-,13-/m1/s1 |
| InChIKey | KIWCZOZTIMAKDZ-JHJVBQTASA-N |
| XLogP | 1.65 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|