C20H24N4O6 — CID 46513793
1-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-3-(3-nitrophenyl)urea (PubChem CID 46513793) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is 1-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-3-(3-nitrophenyl)urea.
| Compound Name | 1-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-3-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 46513793 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-3-(3-nitrophenyl)urea |
| SMILES | COc1cc(C(=O)NNC(=O)Nc2cccc([N+](=O)[O-])c2)ccc1OCCC(C)C |
| InChI | InChI=1S/C20H24N4O6/c1-13(2)9-10-30-17-8-7-14(11-18(17)29-3)19(25)22-23-20(26)21-15-5-4-6-16(12-15)24(27)28/h4-8,11-13H,9-10H2,1-3H3,(H,22,25)(H2,21,23,26) |
| InChIKey | ZNHQFZMUMWBHMV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|